C9H10ClF4N3 — CID 106293438
6-chloro-2,5-dimethyl-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-amine (PubChem CID 106293438) has the molecular formula C9H10ClF4N3 and a molecular weight of 271.65 g/mol. Its IUPAC name is 6-chloro-2,5-dimethyl-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2,5-dimethyl-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106293438 |
| Molecular Formula | C9H10ClF4N3 |
| Molecular Weight | 271.65 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 6-chloro-2,5-dimethyl-N-(2,2,3,3-tetrafluoropropyl)pyrimidin-4-amine |
| SMILES | Cc1nc(Cl)c(C)c(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H10ClF4N3/c1-4-6(10)16-5(2)17-7(4)15-3-9(13,14)8(11)12/h8H,3H2,1-2H3,(H,15,16,17) |
| InChIKey | VYQQUTIPFDNEHW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|