C8H8ClF4N3 — CID 106289897
3-chloro-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine (PubChem CID 106289897) has the molecular formula C8H8ClF4N3 and a molecular weight of 257.62 g/mol. Its IUPAC name is 3-chloro-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine.
| Compound Name | 3-chloro-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 106289897 |
| Molecular Formula | C8H8ClF4N3 |
| Molecular Weight | 257.62 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 3-chloro-2-N-(2,2,3,3-tetrafluoropropyl)pyridine-2,5-diamine |
| SMILES | Nc1cnc(NCC(F)(F)C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H8ClF4N3/c9-5-1-4(14)2-15-6(5)16-3-8(12,13)7(10)11/h1-2,7H,3,14H2,(H,15,16) |
| InChIKey | KVMOLCGGZAELEA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|