C13H10F4N2O2 — CID 106293362
4-(2,2,3,3-tetrafluoropropylamino)quinoline-2-carboxylic acid (PubChem CID 106293362) has the molecular formula C13H10F4N2O2 and a molecular weight of 302.23 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropylamino)quinoline-2-carboxylic acid.
| Compound Name | 4-(2,2,3,3-tetrafluoropropylamino)quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 106293362 |
| Molecular Formula | C13H10F4N2O2 |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropylamino)quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cc(NCC(F)(F)C(F)F)c2ccccc2n1 |
| InChI | InChI=1S/C13H10F4N2O2/c14-12(15)13(16,17)6-18-9-5-10(11(20)21)19-8-4-2-1-3-7(8)9/h1-5,12H,6H2,(H,18,19)(H,20,21) |
| InChIKey | HMLMUEJWRJGTIA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|