C15H19N3O2 — CID 63377739
4-[2-(dimethylamino)propylamino]quinoline-2-carboxylic acid (PubChem CID 63377739) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[2-(dimethylamino)propylamino]quinoline-2-carboxylic acid.
| Compound Name | 4-[2-(dimethylamino)propylamino]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 63377739 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[2-(dimethylamino)propylamino]quinoline-2-carboxylic acid |
| SMILES | CC(CNc1cc(C(=O)O)nc2ccccc12)N(C)C |
| InChI | InChI=1S/C15H19N3O2/c1-10(18(2)3)9-16-13-8-14(15(19)20)17-12-7-5-4-6-11(12)13/h4-8,10H,9H2,1-3H3,(H,16,17)(H,19,20) |
| InChIKey | ZUVNMTXASIZOIJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |