C9H10F3N3O3 — CID 107553989
2-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-4-carboxylic acid (PubChem CID 107553989) has the molecular formula C9H10F3N3O3 and a molecular weight of 265.19 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-4-carboxylic acid.
| Compound Name | 2-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107553989 |
| Molecular Formula | C9H10F3N3O3 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H10F3N3O3/c10-9(11,12)5-18-4-3-14-8-13-2-1-6(15-8)7(16)17/h1-2H,3-5H2,(H,16,17)(H,13,14,15) |
| InChIKey | IWABBGVTDCEPKN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|