C9H13N3O3S — CID 107554398
2-(2-methylsulfinylpropylamino)pyrimidine-4-carboxylic acid (PubChem CID 107554398) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-(2-methylsulfinylpropylamino)pyrimidine-4-carboxylic acid.
| Compound Name | 2-(2-methylsulfinylpropylamino)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107554398 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-(2-methylsulfinylpropylamino)pyrimidine-4-carboxylic acid |
| SMILES | CC(CNc1nccc(C(=O)O)n1)S(C)=O |
| InChI | InChI=1S/C9H13N3O3S/c1-6(16(2)15)5-11-9-10-4-3-7(12-9)8(13)14/h3-4,6H,5H2,1-2H3,(H,13,14)(H,10,11,12) |
| InChIKey | KZCZEIPCGRBXDH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |