C17H16N4O — CID 133332712
4-methoxy-N-[(4-pyridin-3-ylphenyl)methyl]pyrimidin-2-amine (PubChem CID 133332712) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-methoxy-N-[(4-pyridin-3-ylphenyl)methyl]pyrimidin-2-amine.
| Compound Name | 4-methoxy-N-[(4-pyridin-3-ylphenyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 133332712 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-methoxy-N-[(4-pyridin-3-ylphenyl)methyl]pyrimidin-2-amine |
| SMILES | COc1ccnc(NCc2ccc(-c3cccnc3)cc2)n1 |
| InChI | InChI=1S/C17H16N4O/c1-22-16-8-10-19-17(21-16)20-11-13-4-6-14(7-5-13)15-3-2-9-18-12-15/h2-10,12H,11H2,1H3,(H,19,20,21) |
| InChIKey | AALMLJFMISYOJM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |