C10H11N3OS — CID 112685174
4-methoxy-N-(thiophen-3-ylmethyl)pyrimidin-2-amine (PubChem CID 112685174) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is 4-methoxy-N-(thiophen-3-ylmethyl)pyrimidin-2-amine.
| Compound Name | 4-methoxy-N-(thiophen-3-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112685174 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 4-methoxy-N-(thiophen-3-ylmethyl)pyrimidin-2-amine |
| SMILES | COc1ccnc(NCc2ccsc2)n1 |
| InChI | InChI=1S/C10H11N3OS/c1-14-9-2-4-11-10(13-9)12-6-8-3-5-15-7-8/h2-5,7H,6H2,1H3,(H,11,12,13) |
| InChIKey | RMRAZCWLPYBNAI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |