C12H13ClN4OS — CID 43737681
4-chloro-N,N-dimethyl-2-(thiadiazol-4-ylmethylamino)benzamide (PubChem CID 43737681) has the molecular formula C12H13ClN4OS and a molecular weight of 296.78 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-2-(thiadiazol-4-ylmethylamino)benzamide.
| Compound Name | 4-chloro-N,N-dimethyl-2-(thiadiazol-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 43737681 |
| Molecular Formula | C12H13ClN4OS |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 4-chloro-N,N-dimethyl-2-(thiadiazol-4-ylmethylamino)benzamide |
| SMILES | CN(C)C(=O)c1ccc(Cl)cc1NCc1csnn1 |
| InChI | InChI=1S/C12H13ClN4OS/c1-17(2)12(18)10-4-3-8(13)5-11(10)14-6-9-7-19-16-15-9/h3-5,7,14H,6H2,1-2H3 |
| InChIKey | DGPKNGNBXSAFEB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |