C12H18N2O4 — CID 21453600
N-[3-(2,2-dihydroxyethylamino)-4-ethoxyphenyl]acetamide (PubChem CID 21453600) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is N-[3-(2,2-dihydroxyethylamino)-4-ethoxyphenyl]acetamide.
| Compound Name | N-[3-(2,2-dihydroxyethylamino)-4-ethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 21453600 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N-[3-(2,2-dihydroxyethylamino)-4-ethoxyphenyl]acetamide |
| SMILES | CCOc1ccc(NC(C)=O)cc1NCC(O)O |
| InChI | InChI=1S/C12H18N2O4/c1-3-18-11-5-4-9(14-8(2)15)6-10(11)13-7-12(16)17/h4-6,12-13,16-17H,3,7H2,1-2H3,(H,14,15) |
| InChIKey | YMDJUIKUBIXYPS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|