C11H8BrFN6 — CID 169343853
3-(3-bromo-4-fluoro-5-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343853) has the molecular formula C11H8BrFN6 and a molecular weight of 323.13 g/mol. Its IUPAC name is 3-(3-bromo-4-fluoro-5-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(3-bromo-4-fluoro-5-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343853 |
| Molecular Formula | C11H8BrFN6 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 3-(3-bromo-4-fluoro-5-methylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1cc(NC=C(C#N)c2nn[nH]n2)cc(Br)c1F |
| InChI | InChI=1S/C11H8BrFN6/c1-6-2-8(3-9(12)10(6)13)15-5-7(4-14)11-16-18-19-17-11/h2-3,5,15H,1H3,(H,16,17,18,19) |
| InChIKey | QQSNZFQUMCMSOQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|