C10H11BrF2N2O3 — CID 135339733
1-(4-bromo-2,3-difluoro-6-nitroanilino)-2-methylpropan-2-ol (PubChem CID 135339733) has the molecular formula C10H11BrF2N2O3 and a molecular weight of 325.11 g/mol. Its IUPAC name is 1-(4-bromo-2,3-difluoro-6-nitroanilino)-2-methylpropan-2-ol.
| Compound Name | 1-(4-bromo-2,3-difluoro-6-nitroanilino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 135339733 |
| Molecular Formula | C10H11BrF2N2O3 |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 1-(4-bromo-2,3-difluoro-6-nitroanilino)-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CNc1c([N+](=O)[O-])cc(Br)c(F)c1F |
| InChI | InChI=1S/C10H11BrF2N2O3/c1-10(2,16)4-14-9-6(15(17)18)3-5(11)7(12)8(9)13/h3,14,16H,4H2,1-2H3 |
| InChIKey | MCJVHICEARNYRX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|