C11H12F2N2O4 — CID 65107214
4,5-difluoro-N-(2-hydroxy-2-methylpropyl)-2-nitrobenzamide (PubChem CID 65107214) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is 4,5-difluoro-N-(2-hydroxy-2-methylpropyl)-2-nitrobenzamide.
| Compound Name | 4,5-difluoro-N-(2-hydroxy-2-methylpropyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 65107214 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4,5-difluoro-N-(2-hydroxy-2-methylpropyl)-2-nitrobenzamide |
| SMILES | CC(C)(O)CNC(=O)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12F2N2O4/c1-11(2,17)5-14-10(16)6-3-7(12)8(13)4-9(6)15(18)19/h3-4,17H,5H2,1-2H3,(H,14,16) |
| InChIKey | AHFXTBDROBRTLB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|