C12H12F2N2O4 — CID 64996647
4,5-difluoro-N-(3-methyl-2-oxobutyl)-2-nitrobenzamide (PubChem CID 64996647) has the molecular formula C12H12F2N2O4 and a molecular weight of 286.23 g/mol. Its IUPAC name is 4,5-difluoro-N-(3-methyl-2-oxobutyl)-2-nitrobenzamide.
| Compound Name | 4,5-difluoro-N-(3-methyl-2-oxobutyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 64996647 |
| Molecular Formula | C12H12F2N2O4 |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4,5-difluoro-N-(3-methyl-2-oxobutyl)-2-nitrobenzamide |
| SMILES | CC(C)C(=O)CNC(=O)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12F2N2O4/c1-6(2)11(17)5-15-12(18)7-3-8(13)9(14)4-10(7)16(19)20/h3-4,6H,5H2,1-2H3,(H,15,18) |
| InChIKey | TWFDSZXXRNRENV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|