C12H14F2N2O4 — CID 66092519
4,5-difluoro-N-(4-hydroxy-2-methylbutyl)-2-nitrobenzamide (PubChem CID 66092519) has the molecular formula C12H14F2N2O4 and a molecular weight of 288.25 g/mol. Its IUPAC name is 4,5-difluoro-N-(4-hydroxy-2-methylbutyl)-2-nitrobenzamide.
| Compound Name | 4,5-difluoro-N-(4-hydroxy-2-methylbutyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 66092519 |
| Molecular Formula | C12H14F2N2O4 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4,5-difluoro-N-(4-hydroxy-2-methylbutyl)-2-nitrobenzamide |
| SMILES | CC(CCO)CNC(=O)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14F2N2O4/c1-7(2-3-17)6-15-12(18)8-4-9(13)10(14)5-11(8)16(19)20/h4-5,7,17H,2-3,6H2,1H3,(H,15,18) |
| InChIKey | KIGMJTNXBNEODL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|