C12H13F2N3O4 — CID 104579559
N-(4-amino-2-methyl-4-oxobutan-2-yl)-4,5-difluoro-2-nitrobenzamide (PubChem CID 104579559) has the molecular formula C12H13F2N3O4 and a molecular weight of 301.25 g/mol. Its IUPAC name is N-(4-amino-2-methyl-4-oxobutan-2-yl)-4,5-difluoro-2-nitrobenzamide.
| Compound Name | N-(4-amino-2-methyl-4-oxobutan-2-yl)-4,5-difluoro-2-nitrobenzamide |
|---|---|
| PubChem CID | 104579559 |
| Molecular Formula | C12H13F2N3O4 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-(4-amino-2-methyl-4-oxobutan-2-yl)-4,5-difluoro-2-nitrobenzamide |
| SMILES | CC(C)(CC(N)=O)NC(=O)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13F2N3O4/c1-12(2,5-10(15)18)16-11(19)6-3-7(13)8(14)4-9(6)17(20)21/h3-4H,5H2,1-2H3,(H2,15,18)(H,16,19) |
| InChIKey | SUGSAGYOUUAZLZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|