C13H19FN4O3 — CID 106331390
4-fluoro-5-hydrazinyl-N-(3-methylpentan-3-yl)-2-nitrobenzamide (PubChem CID 106331390) has the molecular formula C13H19FN4O3 and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-fluoro-5-hydrazinyl-N-(3-methylpentan-3-yl)-2-nitrobenzamide.
| Compound Name | 4-fluoro-5-hydrazinyl-N-(3-methylpentan-3-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 106331390 |
| Molecular Formula | C13H19FN4O3 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-fluoro-5-hydrazinyl-N-(3-methylpentan-3-yl)-2-nitrobenzamide |
| SMILES | CCC(C)(CC)NC(=O)c1cc(NN)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19FN4O3/c1-4-13(3,5-2)16-12(19)8-6-10(17-15)9(14)7-11(8)18(20)21/h6-7,17H,4-5,15H2,1-3H3,(H,16,19) |
| InChIKey | GXSIGDXCVDYJAJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|