C11H14FN5O4 — CID 62236532
N-(4-amino-4-oxobutyl)-4-fluoro-5-hydrazinyl-2-nitrobenzamide (PubChem CID 62236532) has the molecular formula C11H14FN5O4 and a molecular weight of 299.26 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-4-fluoro-5-hydrazinyl-2-nitrobenzamide.
| Compound Name | N-(4-amino-4-oxobutyl)-4-fluoro-5-hydrazinyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 62236532 |
| Molecular Formula | C11H14FN5O4 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-4-fluoro-5-hydrazinyl-2-nitrobenzamide |
| SMILES | NNc1cc(C(=O)NCCCC(N)=O)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H14FN5O4/c12-7-5-9(17(20)21)6(4-8(7)16-14)11(19)15-3-1-2-10(13)18/h4-5,16H,1-3,14H2,(H2,13,18)(H,15,19) |
| InChIKey | KXCBRTMIDVPNJU-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|