C11H11FN6O3 — CID 64523214
4-fluoro-5-hydrazinyl-N-(1H-imidazol-2-ylmethyl)-2-nitrobenzamide (PubChem CID 64523214) has the molecular formula C11H11FN6O3 and a molecular weight of 294.25 g/mol. Its IUPAC name is 4-fluoro-5-hydrazinyl-N-(1H-imidazol-2-ylmethyl)-2-nitrobenzamide.
| Compound Name | 4-fluoro-5-hydrazinyl-N-(1H-imidazol-2-ylmethyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 64523214 |
| Molecular Formula | C11H11FN6O3 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-fluoro-5-hydrazinyl-N-(1H-imidazol-2-ylmethyl)-2-nitrobenzamide |
| SMILES | NNc1cc(C(=O)NCc2ncc[nH]2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H11FN6O3/c12-7-4-9(18(20)21)6(3-8(7)17-13)11(19)16-5-10-14-1-2-15-10/h1-4,17H,5,13H2,(H,14,15)(H,16,19) |
| InChIKey | MVLSKGXXRIRBTC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 138.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|