methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate

C14H12Br3NO3 — CID 104652809

IUPACmethyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate
SMILESCOC(=O)c1cc(Br)cc(Br)c1NC(C)c1ccc(Br)o1
InChIInChI=1S/C14H12Br3NO3/c1-7(11-3-4-12(17)21-11)18-13-9(14(19)20-2)5-8(15)6-10(13)16/h3-7,18H,1-2H3
InChIKeyOWOPYAMTXUHLSZ-UHFFFAOYSA-N
MW481.97 g/mol
LogP5.53
Rot. Bonds4

About methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate

methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate (PubChem CID 104652809) has the molecular formula C14H12Br3NO3 and a molecular weight of 481.97 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate.

Molecular Properties

Compound Namemethyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate
PubChem CID104652809
Molecular FormulaC14H12Br3NO3
Molecular Weight481.97 g/mol
Exact Mass478.84
IUPAC Namemethyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate
SMILESCOC(=O)c1cc(Br)cc(Br)c1NC(C)c1ccc(Br)o1
InChIInChI=1S/C14H12Br3NO3/c1-7(11-3-4-12(17)21-11)18-13-9(14(19)20-2)5-8(15)6-10(13)16/h3-7,18H,1-2H3
InChIKeyOWOPYAMTXUHLSZ-UHFFFAOYSA-N
XLogP5.53
TPSA51.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500481.97
LogP ≤ 55.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate?
The IUPAC name of methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate (CID 104652809) is methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate.
What is the SMILES notation for methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate?
The canonical SMILES for methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate is COC(=O)c1cc(Br)cc(Br)c1NC(C)c1ccc(Br)o1.
What is the InChIKey of methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate?
The InChIKey is OWOPYAMTXUHLSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Br3NO3/c1-7(11-3-4-12(17)21-11)18-13-9(14(19)20-2)5-8(15)6-10(13)16/h3-7,18H,1-2H3.
What are the key properties of methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate?
methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate has a molecular weight of 481.97 g/mol, XLogP of 5.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-dibromo-2-[1-(5-bromofuran-2-yl)ethylamino]benzoate is sourced from PubChem (CID 104652809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).