About methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate
methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate (PubChem CID 103236832) has the molecular formula C15H15Br2NO3
and a molecular weight of 417.10 g/mol. Its IUPAC name is methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate |
| PubChem CID | 103236832 |
| Molecular Formula | C15H15Br2NO3 |
| Molecular Weight | 417.10 g/mol |
| Exact Mass | 414.94 |
| IUPAC Name | methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)Nc2c(Br)cc(C)cc2Br)o1 |
| InChI | InChI=1S/C15H15Br2NO3/c1-8-6-10(16)14(11(17)7-8)18-9(2)12-4-5-13(21-12)15(19)20-3/h4-7,9,18H,1-3H3 |
| InChIKey | HKNXCYXURFPERW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.10 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate (CID 103236832) is methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate is COC(=O)c1ccc(C(C)Nc2c(Br)cc(C)cc2Br)o1.
What is the InChIKey of methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate?
The InChIKey is HKNXCYXURFPERW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Br2NO3/c1-8-6-10(16)14(11(17)7-8)18-9(2)12-4-5-13(21-12)15(19)20-3/h4-7,9,18H,1-3H3.
What are the key properties of methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate?
methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate has a molecular weight of 417.10 g/mol, XLogP of 5.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[1-(2,6-dibromo-4-methylanilino)ethyl]furan-2-carboxylate is sourced from PubChem (CID 103236832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).