C13H14Br2N2O4 — CID 64892746
methyl 2-[(3-aminooxolane-3-carbonyl)amino]-3,5-dibromobenzoate (PubChem CID 64892746) has the molecular formula C13H14Br2N2O4 and a molecular weight of 422.07 g/mol. Its IUPAC name is methyl 2-[(3-aminooxolane-3-carbonyl)amino]-3,5-dibromobenzoate.
| Compound Name | methyl 2-[(3-aminooxolane-3-carbonyl)amino]-3,5-dibromobenzoate |
|---|---|
| PubChem CID | 64892746 |
| Molecular Formula | C13H14Br2N2O4 |
| Molecular Weight | 422.07 g/mol |
| Exact Mass | 419.93 |
| IUPAC Name | methyl 2-[(3-aminooxolane-3-carbonyl)amino]-3,5-dibromobenzoate |
| SMILES | COC(=O)c1cc(Br)cc(Br)c1NC(=O)C1(N)CCOC1 |
| InChI | InChI=1S/C13H14Br2N2O4/c1-20-11(18)8-4-7(14)5-9(15)10(8)17-12(19)13(16)2-3-21-6-13/h4-5H,2-3,6,16H2,1H3,(H,17,19) |
| InChIKey | BLQUYXAZUJCWFF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.07 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |