C16H21Br2NO2 — CID 63451936
methyl 3,5-dibromo-2-(cyclooctylamino)benzoate (PubChem CID 63451936) has the molecular formula C16H21Br2NO2 and a molecular weight of 419.16 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-(cyclooctylamino)benzoate.
| Compound Name | methyl 3,5-dibromo-2-(cyclooctylamino)benzoate |
|---|---|
| PubChem CID | 63451936 |
| Molecular Formula | C16H21Br2NO2 |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | methyl 3,5-dibromo-2-(cyclooctylamino)benzoate |
| SMILES | COC(=O)c1cc(Br)cc(Br)c1NC1CCCCCCC1 |
| InChI | InChI=1S/C16H21Br2NO2/c1-21-16(20)13-9-11(17)10-14(18)15(13)19-12-7-5-3-2-4-6-8-12/h9-10,12,19H,2-8H2,1H3 |
| InChIKey | YZDZELSPRFBZAT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |