methyl 3,5-dibromo-2-(cyclooctylamino)benzoate

C16H21Br2NO2 — CID 63451936

IUPACmethyl 3,5-dibromo-2-(cyclooctylamino)benzoate
SMILESCOC(=O)c1cc(Br)cc(Br)c1NC1CCCCCCC1
InChIInChI=1S/C16H21Br2NO2/c1-21-16(20)13-9-11(17)10-14(18)15(13)19-12-7-5-3-2-4-6-8-12/h9-10,12,19H,2-8H2,1H3
InChIKeyYZDZELSPRFBZAT-UHFFFAOYSA-N
MW419.16 g/mol
LogP5.52
Rot. Bonds3

About methyl 3,5-dibromo-2-(cyclooctylamino)benzoate

methyl 3,5-dibromo-2-(cyclooctylamino)benzoate (PubChem CID 63451936) has the molecular formula C16H21Br2NO2 and a molecular weight of 419.16 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-(cyclooctylamino)benzoate.

Molecular Properties

Compound Namemethyl 3,5-dibromo-2-(cyclooctylamino)benzoate
PubChem CID63451936
Molecular FormulaC16H21Br2NO2
Molecular Weight419.16 g/mol
Exact Mass416.99
IUPAC Namemethyl 3,5-dibromo-2-(cyclooctylamino)benzoate
SMILESCOC(=O)c1cc(Br)cc(Br)c1NC1CCCCCCC1
InChIInChI=1S/C16H21Br2NO2/c1-21-16(20)13-9-11(17)10-14(18)15(13)19-12-7-5-3-2-4-6-8-12/h9-10,12,19H,2-8H2,1H3
InChIKeyYZDZELSPRFBZAT-UHFFFAOYSA-N
XLogP5.52
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500419.16
LogP ≤ 55.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3,5-dibromo-2-(cyclooctylamino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,5-dibromo-2-(cyclooctylamino)benzoate?
The IUPAC name of methyl 3,5-dibromo-2-(cyclooctylamino)benzoate (CID 63451936) is methyl 3,5-dibromo-2-(cyclooctylamino)benzoate.
What is the SMILES notation for methyl 3,5-dibromo-2-(cyclooctylamino)benzoate?
The canonical SMILES for methyl 3,5-dibromo-2-(cyclooctylamino)benzoate is COC(=O)c1cc(Br)cc(Br)c1NC1CCCCCCC1.
What is the InChIKey of methyl 3,5-dibromo-2-(cyclooctylamino)benzoate?
The InChIKey is YZDZELSPRFBZAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Br2NO2/c1-21-16(20)13-9-11(17)10-14(18)15(13)19-12-7-5-3-2-4-6-8-12/h9-10,12,19H,2-8H2,1H3.
What are the key properties of methyl 3,5-dibromo-2-(cyclooctylamino)benzoate?
methyl 3,5-dibromo-2-(cyclooctylamino)benzoate has a molecular weight of 419.16 g/mol, XLogP of 5.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-dibromo-2-(cyclooctylamino)benzoate is sourced from PubChem (CID 63451936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).