C10H12BrCl2NO2S2 — CID 63961201
4-bromo-2,6-dichloro-N-(3-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 63961201) has the molecular formula C10H12BrCl2NO2S2 and a molecular weight of 393.16 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(3-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(3-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63961201 |
| Molecular Formula | C10H12BrCl2NO2S2 |
| Molecular Weight | 393.16 g/mol |
| Exact Mass | 390.89 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(3-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CSCCCNS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H12BrCl2NO2S2/c1-17-4-2-3-14-18(15,16)10-8(12)5-7(11)6-9(10)13/h5-6,14H,2-4H2,1H3 |
| InChIKey | VRYAWTHEEHUZEV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|