C16H19FO2S — CID 76996103
3-[4-(cyclohexylsulfanylmethyl)-3-fluorophenyl]prop-2-enoic acid (PubChem CID 76996103) has the molecular formula C16H19FO2S and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-[4-(cyclohexylsulfanylmethyl)-3-fluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(cyclohexylsulfanylmethyl)-3-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76996103 |
| Molecular Formula | C16H19FO2S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-[4-(cyclohexylsulfanylmethyl)-3-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CSC2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C16H19FO2S/c17-15-10-12(7-9-16(18)19)6-8-13(15)11-20-14-4-2-1-3-5-14/h6-10,14H,1-5,11H2,(H,18,19) |
| InChIKey | SMIRRYMRIGMGAE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|