C15H17FN2O2 — CID 65366205
4-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,4-diazepan-2-one (PubChem CID 65366205) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 4-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,4-diazepan-2-one.
| Compound Name | 4-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65366205 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-[[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(Cc2ccc(C#CCO)cc2F)CCCN1 |
| InChI | InChI=1S/C15H17FN2O2/c16-14-9-12(3-1-8-19)4-5-13(14)10-18-7-2-6-17-15(20)11-18/h4-5,9,19H,2,6-8,10-11H2,(H,17,20) |
| InChIKey | YUHZHQCHPYULPD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|