C14H13FN2O3 — CID 66084808
4-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]methyl]piperazine-2,6-dione (PubChem CID 66084808) has the molecular formula C14H13FN2O3 and a molecular weight of 276.27 g/mol. Its IUPAC name is 4-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]methyl]piperazine-2,6-dione.
| Compound Name | 4-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]methyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66084808 |
| Molecular Formula | C14H13FN2O3 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-[[4-fluoro-2-(3-hydroxyprop-1-ynyl)phenyl]methyl]piperazine-2,6-dione |
| SMILES | O=C1CN(Cc2ccc(F)cc2C#CCO)CC(=O)N1 |
| InChI | InChI=1S/C14H13FN2O3/c15-12-4-3-11(10(6-12)2-1-5-18)7-17-8-13(19)16-14(20)9-17/h3-4,6,18H,5,7-9H2,(H,16,19,20) |
| InChIKey | SKSNGDUXPXASPQ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|