C17H22FNOS — CID 107458679
3-[2-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-5-fluorophenyl]prop-2-yn-1-ol (PubChem CID 107458679) has the molecular formula C17H22FNOS and a molecular weight of 307.43 g/mol. Its IUPAC name is 3-[2-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-5-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-5-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 107458679 |
| Molecular Formula | C17H22FNOS |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-[2-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]-5-fluorophenyl]prop-2-yn-1-ol |
| SMILES | CC1(C)CCN(Cc2ccc(F)cc2C#CCO)CCS1 |
| InChI | InChI=1S/C17H22FNOS/c1-17(2)7-8-19(9-11-21-17)13-15-5-6-16(18)12-14(15)4-3-10-20/h5-6,12,20H,7-11,13H2,1-2H3 |
| InChIKey | DQKYRPPNNFUUKN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|