C18H24FNO — CID 65282605
3-[4-[(4,4-dimethylazepan-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol (PubChem CID 65282605) has the molecular formula C18H24FNO and a molecular weight of 289.39 g/mol. Its IUPAC name is 3-[4-[(4,4-dimethylazepan-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-[(4,4-dimethylazepan-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 65282605 |
| Molecular Formula | C18H24FNO |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 3-[4-[(4,4-dimethylazepan-1-yl)methyl]-3-fluorophenyl]prop-2-yn-1-ol |
| SMILES | CC1(C)CCCN(Cc2ccc(C#CCO)cc2F)CC1 |
| InChI | InChI=1S/C18H24FNO/c1-18(2)8-4-10-20(11-9-18)14-16-7-6-15(5-3-12-21)13-17(16)19/h6-7,13,21H,4,8-12,14H2,1-2H3 |
| InChIKey | SUFZLOPYOGLNDL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|