C10H10FNO3S — CID 60813247
N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methanesulfonamide (PubChem CID 60813247) has the molecular formula C10H10FNO3S and a molecular weight of 243.26 g/mol. Its IUPAC name is N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methanesulfonamide.
| Compound Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 60813247 |
| Molecular Formula | C10H10FNO3S |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C#CCO)cc1F |
| InChI | InChI=1S/C10H10FNO3S/c1-16(14,15)12-10-5-4-8(3-2-6-13)7-9(10)11/h4-5,7,12-13H,6H2,1H3 |
| InChIKey | HELSYJGXDSAIEE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|