C15H12FNO3S — CID 60813246
N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]benzenesulfonamide (PubChem CID 60813246) has the molecular formula C15H12FNO3S and a molecular weight of 305.33 g/mol. Its IUPAC name is N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60813246 |
| Molecular Formula | C15H12FNO3S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-[2-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(C#CCO)cc1F)c1ccccc1 |
| InChI | InChI=1S/C15H12FNO3S/c16-14-11-12(5-4-10-18)8-9-15(14)17-21(19,20)13-6-2-1-3-7-13/h1-3,6-9,11,17-18H,10H2 |
| InChIKey | QSBYDUKHRBJCOD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|