C11H10F3NO3S — CID 54922688
1,1-difluoro-N-[2-fluoro-4-(4-hydroxybut-1-ynyl)phenyl]methanesulfonamide (PubChem CID 54922688) has the molecular formula C11H10F3NO3S and a molecular weight of 293.27 g/mol. Its IUPAC name is 1,1-difluoro-N-[2-fluoro-4-(4-hydroxybut-1-ynyl)phenyl]methanesulfonamide.
| Compound Name | 1,1-difluoro-N-[2-fluoro-4-(4-hydroxybut-1-ynyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 54922688 |
| Molecular Formula | C11H10F3NO3S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 1,1-difluoro-N-[2-fluoro-4-(4-hydroxybut-1-ynyl)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(C#CCCO)cc1F)C(F)F |
| InChI | InChI=1S/C11H10F3NO3S/c12-9-7-8(3-1-2-6-16)4-5-10(9)15-19(17,18)11(13)14/h4-5,7,11,15-16H,2,6H2 |
| InChIKey | CZIWYUORDULVLJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|