C11H11F2NO3S — CID 60813589
1,1-difluoro-N-[3-(4-hydroxybut-1-ynyl)phenyl]methanesulfonamide (PubChem CID 60813589) has the molecular formula C11H11F2NO3S and a molecular weight of 275.28 g/mol. Its IUPAC name is 1,1-difluoro-N-[3-(4-hydroxybut-1-ynyl)phenyl]methanesulfonamide.
| Compound Name | 1,1-difluoro-N-[3-(4-hydroxybut-1-ynyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 60813589 |
| Molecular Formula | C11H11F2NO3S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 1,1-difluoro-N-[3-(4-hydroxybut-1-ynyl)phenyl]methanesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(C#CCCO)c1)C(F)F |
| InChI | InChI=1S/C11H11F2NO3S/c12-11(13)18(16,17)14-10-6-3-5-9(8-10)4-1-2-7-15/h3,5-6,8,11,14-15H,2,7H2 |
| InChIKey | ZJDRHKAUDVUIIZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|