C14H20FNO2S — CID 106665750
4-fluoro-3-[(3-methoxy-3-methylbutoxy)methyl]benzenecarbothioamide (PubChem CID 106665750) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is 4-fluoro-3-[(3-methoxy-3-methylbutoxy)methyl]benzenecarbothioamide.
| Compound Name | 4-fluoro-3-[(3-methoxy-3-methylbutoxy)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 106665750 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-fluoro-3-[(3-methoxy-3-methylbutoxy)methyl]benzenecarbothioamide |
| SMILES | COC(C)(C)CCOCc1cc(C(N)=S)ccc1F |
| InChI | InChI=1S/C14H20FNO2S/c1-14(2,17-3)6-7-18-9-11-8-10(13(16)19)4-5-12(11)15/h4-5,8H,6-7,9H2,1-3H3,(H2,16,19) |
| InChIKey | YDEZCMVGLAYMCN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|