C15H13F2NOS — CID 102981854
4-fluoro-3-[(5-fluoro-2-methylphenoxy)methyl]benzenecarbothioamide (PubChem CID 102981854) has the molecular formula C15H13F2NOS and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-fluoro-3-[(5-fluoro-2-methylphenoxy)methyl]benzenecarbothioamide.
| Compound Name | 4-fluoro-3-[(5-fluoro-2-methylphenoxy)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102981854 |
| Molecular Formula | C15H13F2NOS |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-fluoro-3-[(5-fluoro-2-methylphenoxy)methyl]benzenecarbothioamide |
| SMILES | Cc1ccc(F)cc1OCc1cc(C(N)=S)ccc1F |
| InChI | InChI=1S/C15H13F2NOS/c1-9-2-4-12(16)7-14(9)19-8-11-6-10(15(18)20)3-5-13(11)17/h2-7H,8H2,1H3,(H2,18,20) |
| InChIKey | JRLSUNXFTNBUAR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|