C11H12F4N2O2 — CID 107458270
4-fluoro-3-(3,3,3-trifluoropropoxymethyl)benzohydrazide (PubChem CID 107458270) has the molecular formula C11H12F4N2O2 and a molecular weight of 280.22 g/mol. Its IUPAC name is 4-fluoro-3-(3,3,3-trifluoropropoxymethyl)benzohydrazide.
| Compound Name | 4-fluoro-3-(3,3,3-trifluoropropoxymethyl)benzohydrazide |
|---|---|
| PubChem CID | 107458270 |
| Molecular Formula | C11H12F4N2O2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 4-fluoro-3-(3,3,3-trifluoropropoxymethyl)benzohydrazide |
| SMILES | NNC(=O)c1ccc(F)c(COCCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F4N2O2/c12-9-2-1-7(10(18)17-16)5-8(9)6-19-4-3-11(13,14)15/h1-2,5H,3-4,6,16H2,(H,17,18) |
| InChIKey | NJVAPTVVJBZBCW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|