C15H23FN2O2 — CID 107458143
4-fluoro-3-(heptoxymethyl)benzohydrazide (PubChem CID 107458143) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-fluoro-3-(heptoxymethyl)benzohydrazide.
| Compound Name | 4-fluoro-3-(heptoxymethyl)benzohydrazide |
|---|---|
| PubChem CID | 107458143 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 4-fluoro-3-(heptoxymethyl)benzohydrazide |
| SMILES | CCCCCCCOCc1cc(C(=O)NN)ccc1F |
| InChI | InChI=1S/C15H23FN2O2/c1-2-3-4-5-6-9-20-11-13-10-12(15(19)18-17)7-8-14(13)16/h7-8,10H,2-6,9,11,17H2,1H3,(H,18,19) |
| InChIKey | DVLHXAOKLHWGJH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|