C16H20FNO — CID 66323089
3-[4-(cyclopentylmethoxymethyl)-3-fluorophenyl]prop-2-yn-1-amine (PubChem CID 66323089) has the molecular formula C16H20FNO and a molecular weight of 261.34 g/mol. Its IUPAC name is 3-[4-(cyclopentylmethoxymethyl)-3-fluorophenyl]prop-2-yn-1-amine.
| Compound Name | 3-[4-(cyclopentylmethoxymethyl)-3-fluorophenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 66323089 |
| Molecular Formula | C16H20FNO |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-[4-(cyclopentylmethoxymethyl)-3-fluorophenyl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccc(COCC2CCCC2)c(F)c1 |
| InChI | InChI=1S/C16H20FNO/c17-16-10-13(6-3-9-18)7-8-15(16)12-19-11-14-4-1-2-5-14/h7-8,10,14H,1-2,4-5,9,11-12,18H2 |
| InChIKey | FIENNBIBPAVETM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|