C15H21BrF3NO — CID 102774007
N-[[3-bromo-4-(3,3,3-trifluoropropoxymethyl)phenyl]methyl]-2-methylpropan-1-amine (PubChem CID 102774007) has the molecular formula C15H21BrF3NO and a molecular weight of 368.24 g/mol. Its IUPAC name is N-[[3-bromo-4-(3,3,3-trifluoropropoxymethyl)phenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[3-bromo-4-(3,3,3-trifluoropropoxymethyl)phenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 102774007 |
| Molecular Formula | C15H21BrF3NO |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-[[3-bromo-4-(3,3,3-trifluoropropoxymethyl)phenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccc(COCCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C15H21BrF3NO/c1-11(2)8-20-9-12-3-4-13(14(16)7-12)10-21-6-5-15(17,18)19/h3-4,7,11,20H,5-6,8-10H2,1-2H3 |
| InChIKey | IYMKMZHNSRMEAS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|