C15H17F3O2 — CID 82788667
4-[3-(4,4,4-trifluorobutoxymethyl)phenyl]but-3-yn-1-ol (PubChem CID 82788667) has the molecular formula C15H17F3O2 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-[3-(4,4,4-trifluorobutoxymethyl)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-(4,4,4-trifluorobutoxymethyl)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 82788667 |
| Molecular Formula | C15H17F3O2 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-[3-(4,4,4-trifluorobutoxymethyl)phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cccc(COCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3O2/c16-15(17,18)8-4-10-20-12-14-7-3-6-13(11-14)5-1-2-9-19/h3,6-7,11,19H,2,4,8-10,12H2 |
| InChIKey | UFYKSQRAQMDSTH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|