C28H36Cl2N2O2 — CID 67898556
1-[2-[(3-phenoxyphenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine;dihydrochloride (PubChem CID 67898556) has the molecular formula C28H36Cl2N2O2 and a molecular weight of 503.51 g/mol. Its IUPAC name is 1-[2-[(3-phenoxyphenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine;dihydrochloride.
| Compound Name | 1-[2-[(3-phenoxyphenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine;dihydrochloride |
|---|---|
| PubChem CID | 67898556 |
| Molecular Formula | C28H36Cl2N2O2 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 1-[2-[(3-phenoxyphenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CCCN2CCN(CCOCc3cccc(Oc4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C28H34N2O2.2ClH/c1-3-9-25(10-4-1)12-8-16-29-17-19-30(20-18-29)21-22-31-24-26-11-7-15-28(23-26)32-27-13-5-2-6-14-27;;/h1-7,9-11,13-15,23H,8,12,16-22,24H2;2*1H |
| InChIKey | MKXDTOGLIVCJKP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|