C23H33Cl3N2O2 — CID 19102671
1-[2-[(4-chlorophenyl)methoxy]ethyl]-4-[3-(3-methoxyphenyl)propyl]piperazine;dihydrochloride (PubChem CID 19102671) has the molecular formula C23H33Cl3N2O2 and a molecular weight of 475.89 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)methoxy]ethyl]-4-[3-(3-methoxyphenyl)propyl]piperazine;dihydrochloride.
| Compound Name | 1-[2-[(4-chlorophenyl)methoxy]ethyl]-4-[3-(3-methoxyphenyl)propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 19102671 |
| Molecular Formula | C23H33Cl3N2O2 |
| Molecular Weight | 475.89 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)methoxy]ethyl]-4-[3-(3-methoxyphenyl)propyl]piperazine;dihydrochloride |
| SMILES | COc1cccc(CCCN2CCN(CCOCc3ccc(Cl)cc3)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C23H31ClN2O2.2ClH/c1-27-23-6-2-4-20(18-23)5-3-11-25-12-14-26(15-13-25)16-17-28-19-21-7-9-22(24)10-8-21;;/h2,4,6-10,18H,3,5,11-17,19H2,1H3;2*1H |
| InChIKey | DJZZMZPETUXSHR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|