C23H18F10O9 — CID 59877783
5-[[2-[2-[[2-(1,3-benzodioxol-5-ylmethoxy)-1,1-difluoroethoxy]-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]methyl]-1,3-benzodioxole (PubChem CID 59877783) has the molecular formula C23H18F10O9 and a molecular weight of 628.37 g/mol. Its IUPAC name is 5-[[2-[2-[[2-(1,3-benzodioxol-5-ylmethoxy)-1,1-difluoroethoxy]-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]methyl]-1,3-benzodioxole.
| Compound Name | 5-[[2-[2-[[2-(1,3-benzodioxol-5-ylmethoxy)-1,1-difluoroethoxy]-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 59877783 |
| Molecular Formula | C23H18F10O9 |
| Molecular Weight | 628.37 g/mol |
| Exact Mass | 628.08 |
| IUPAC Name | 5-[[2-[2-[[2-(1,3-benzodioxol-5-ylmethoxy)-1,1-difluoroethoxy]-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethoxy]methyl]-1,3-benzodioxole |
| SMILES | FC(F)(COCc1ccc2c(c1)OCO2)OC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)COCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H18F10O9/c24-19(25,9-34-7-13-1-3-15-17(5-13)38-11-36-15)40-21(28,29)22(30,31)42-23(32,33)41-20(26,27)10-35-8-14-2-4-16-18(6-14)39-12-37-16/h1-6H,7-12H2 |
| InChIKey | OBQSEGKWEJMBDH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.37 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|