C24H25FO2S — CID 15582659
1-fluoro-4-[[2-methyl-2-(4-methylsulfanylphenyl)propoxy]methyl]-2-phenoxybenzene (PubChem CID 15582659) has the molecular formula C24H25FO2S and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-fluoro-4-[[2-methyl-2-(4-methylsulfanylphenyl)propoxy]methyl]-2-phenoxybenzene.
| Compound Name | 1-fluoro-4-[[2-methyl-2-(4-methylsulfanylphenyl)propoxy]methyl]-2-phenoxybenzene |
|---|---|
| PubChem CID | 15582659 |
| Molecular Formula | C24H25FO2S |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-fluoro-4-[[2-methyl-2-(4-methylsulfanylphenyl)propoxy]methyl]-2-phenoxybenzene |
| SMILES | CSc1ccc(C(C)(C)COCc2ccc(F)c(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H25FO2S/c1-24(2,19-10-12-21(28-3)13-11-19)17-26-16-18-9-14-22(25)23(15-18)27-20-7-5-4-6-8-20/h4-15H,16-17H2,1-3H3 |
| InChIKey | KUPKRFRFZXQJSF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |