C25H23F3O2 — CID 70412122
4-[4-[4-(difluoromethoxy)phenyl]hex-5-enyl]-1-fluoro-2-phenoxybenzene (PubChem CID 70412122) has the molecular formula C25H23F3O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-[4-[4-(difluoromethoxy)phenyl]hex-5-enyl]-1-fluoro-2-phenoxybenzene.
| Compound Name | 4-[4-[4-(difluoromethoxy)phenyl]hex-5-enyl]-1-fluoro-2-phenoxybenzene |
|---|---|
| PubChem CID | 70412122 |
| Molecular Formula | C25H23F3O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-[4-[4-(difluoromethoxy)phenyl]hex-5-enyl]-1-fluoro-2-phenoxybenzene |
| SMILES | C=CC(CCCc1ccc(F)c(Oc2ccccc2)c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C25H23F3O2/c1-2-19(20-12-14-22(15-13-20)30-25(27)28)8-6-7-18-11-16-23(26)24(17-18)29-21-9-4-3-5-10-21/h2-5,9-17,19,25H,1,6-8H2 |
| InChIKey | BZLPDGOHAHPLFD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|