C28H28FNO2 — CID 88645591
5-[4-(1,3-benzodioxol-5-yl)-4-ethynylheptyl]-2-fluoro-N-phenylaniline (PubChem CID 88645591) has the molecular formula C28H28FNO2 and a molecular weight of 429.54 g/mol. Its IUPAC name is 5-[4-(1,3-benzodioxol-5-yl)-4-ethynylheptyl]-2-fluoro-N-phenylaniline.
| Compound Name | 5-[4-(1,3-benzodioxol-5-yl)-4-ethynylheptyl]-2-fluoro-N-phenylaniline |
|---|---|
| PubChem CID | 88645591 |
| Molecular Formula | C28H28FNO2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 5-[4-(1,3-benzodioxol-5-yl)-4-ethynylheptyl]-2-fluoro-N-phenylaniline |
| SMILES | C#CC(CCC)(CCCc1ccc(F)c(Nc2ccccc2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H28FNO2/c1-3-16-28(4-2,22-13-15-26-27(19-22)32-20-31-26)17-8-9-21-12-14-24(29)25(18-21)30-23-10-6-5-7-11-23/h2,5-7,10-15,18-19,30H,3,8-9,16-17,20H2,1H3 |
| InChIKey | UWRWXQCYPKVVGU-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|