C13H16O5 — CID 82049533
3-(1,3-benzodioxol-5-yl)-3-hydroxyhexanoic acid (PubChem CID 82049533) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-hydroxyhexanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-3-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 82049533 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-3-hydroxyhexanoic acid |
| SMILES | CCCC(O)(CC(=O)O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H16O5/c1-2-5-13(16,7-12(14)15)9-3-4-10-11(6-9)18-8-17-10/h3-4,6,16H,2,5,7-8H2,1H3,(H,14,15) |
| InChIKey | OSLRRTYLWGZIGY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |