C12H16N2O3 — CID 60786055
2-(1,3-benzodioxol-5-yl)-2-(ethylamino)propanamide (PubChem CID 60786055) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-(ethylamino)propanamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-(ethylamino)propanamide |
|---|---|
| PubChem CID | 60786055 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-(ethylamino)propanamide |
| SMILES | CCNC(C)(C(N)=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H16N2O3/c1-3-14-12(2,11(13)15)8-4-5-9-10(6-8)17-7-16-9/h4-6,14H,3,7H2,1-2H3,(H2,13,15) |
| InChIKey | NEGNBIXKHFILES-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |