C14H20N2O3 — CID 65233837
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(ethylamino)butanamide (PubChem CID 65233837) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(ethylamino)butanamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(ethylamino)butanamide |
|---|---|
| PubChem CID | 65233837 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-(ethylamino)butanamide |
| SMILES | CCNC(C)(CC(N)=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H20N2O3/c1-3-16-14(2,9-13(15)17)10-4-5-11-12(8-10)19-7-6-18-11/h4-5,8,16H,3,6-7,9H2,1-2H3,(H2,15,17) |
| InChIKey | AZIXAFTVCQXTPN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |