C25H26F2OS — CID 70390745
1-fluoro-2-(2-fluorophenoxy)-4-[4-methyl-4-(4-methylsulfanylphenyl)pentyl]benzene (PubChem CID 70390745) has the molecular formula C25H26F2OS and a molecular weight of 412.55 g/mol. Its IUPAC name is 1-fluoro-2-(2-fluorophenoxy)-4-[4-methyl-4-(4-methylsulfanylphenyl)pentyl]benzene.
| Compound Name | 1-fluoro-2-(2-fluorophenoxy)-4-[4-methyl-4-(4-methylsulfanylphenyl)pentyl]benzene |
|---|---|
| PubChem CID | 70390745 |
| Molecular Formula | C25H26F2OS |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-fluoro-2-(2-fluorophenoxy)-4-[4-methyl-4-(4-methylsulfanylphenyl)pentyl]benzene |
| SMILES | CSc1ccc(C(C)(C)CCCc2ccc(F)c(Oc3ccccc3F)c2)cc1 |
| InChI | InChI=1S/C25H26F2OS/c1-25(2,19-11-13-20(29-3)14-12-19)16-6-7-18-10-15-22(27)24(17-18)28-23-9-5-4-8-21(23)26/h4-5,8-15,17H,6-7,16H2,1-3H3 |
| InChIKey | XRMWSKCJYKQFMR-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |